C21H18N4OS — CID 23945009
4-amino-2-anilino-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)thiophene-3-carbonitrile (PubChem CID 23945009) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-amino-2-anilino-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)thiophene-3-carbonitrile.
| Compound Name | 4-amino-2-anilino-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 23945009 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-amino-2-anilino-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)thiophene-3-carbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)sc(C(=O)N2CCc3ccccc3C2)c1N |
| InChI | InChI=1S/C21H18N4OS/c22-12-17-18(23)19(27-20(17)24-16-8-2-1-3-9-16)21(26)25-11-10-14-6-4-5-7-15(14)13-25/h1-9,24H,10-11,13,23H2 |
| InChIKey | KFPIIVNOHZWQOP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_B(12)', 'substructure': 'N/A'} |
|---|