C29H29N5O6S2 — CID 23833247
methyl 2-[3-[[6-amino-3,5-dicyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23833247) has the molecular formula C29H29N5O6S2 and a molecular weight of 607.71 g/mol. Its IUPAC name is methyl 2-[3-[[6-amino-3,5-dicyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[[6-amino-3,5-dicyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23833247 |
| Molecular Formula | C29H29N5O6S2 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | methyl 2-[3-[[6-amino-3,5-dicyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCSc2nc(N)c(C#N)c(-c3cc(OC)c(OC)c(OC)c3)c2C#N)sc2c1CCCC2 |
| InChI | InChI=1S/C29H29N5O6S2/c1-37-19-11-15(12-20(38-2)25(19)39-3)23-17(13-30)26(32)34-27(18(23)14-31)41-10-9-22(35)33-28-24(29(36)40-4)16-7-5-6-8-21(16)42-28/h11-12H,5-10H2,1-4H3,(H2,32,34)(H,33,35) |
| InChIKey | FUJCLCUKPSGVGG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 169.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |