C28H27N5O3S2 — CID 23833228
methyl 2-[3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 23833228) has the molecular formula C28H27N5O3S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is methyl 2-[3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23833228 |
| Molecular Formula | C28H27N5O3S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | methyl 2-[3-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCSc2nc(N)c(C#N)c(-c3ccccc3)c2C#N)sc2c1CCCCCC2 |
| InChI | InChI=1S/C28H27N5O3S2/c1-36-28(35)24-18-11-7-2-3-8-12-21(18)38-27(24)32-22(34)13-14-37-26-20(16-30)23(17-9-5-4-6-10-17)19(15-29)25(31)33-26/h4-6,9-10H,2-3,7-8,11-14H2,1H3,(H2,31,33)(H,32,34) |
| InChIKey | KCIKRTOOPUCZPM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |