C26H23N5O3S2 — CID 23742909
methyl 2-[(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 23742909) has the molecular formula C26H23N5O3S2 and a molecular weight of 517.64 g/mol. Its IUPAC name is methyl 2-[(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23742909 |
| Molecular Formula | C26H23N5O3S2 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | methyl 2-[(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2sc3nc(N)c(C#N)c(-c4ccccc4)c3c2N)sc2c1CCCCC2 |
| InChI | InChI=1S/C26H23N5O3S2/c1-34-26(33)18-14-10-6-3-7-11-16(14)35-24(18)31-23(32)21-20(28)19-17(13-8-4-2-5-9-13)15(12-27)22(29)30-25(19)36-21/h2,4-5,8-9H,3,6-7,10-11,28H2,1H3,(H2,29,30)(H,31,32) |
| InChIKey | PWUGNKCMEMGJDE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |