C28H27N5O3S2 — CID 23858375
methyl 2-[(3,6-diamino-5-cyano-4-propan-2-ylthieno[2,3-b]pyridine-2-carbonyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23858375) has the molecular formula C28H27N5O3S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is methyl 2-[(3,6-diamino-5-cyano-4-propan-2-ylthieno[2,3-b]pyridine-2-carbonyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,6-diamino-5-cyano-4-propan-2-ylthieno[2,3-b]pyridine-2-carbonyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23858375 |
| Molecular Formula | C28H27N5O3S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | methyl 2-[(3,6-diamino-5-cyano-4-propan-2-ylthieno[2,3-b]pyridine-2-carbonyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2sc3nc(N)c(C#N)c(C(C)C)c3c2N)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C28H27N5O3S2/c1-13(2)19-17(12-29)24(31)32-27-21(19)22(30)23(38-27)25(34)33-26-20(28(35)36-3)16-10-9-15(11-18(16)37-26)14-7-5-4-6-8-14/h4-8,13,15H,9-11,30H2,1-3H3,(H2,31,32)(H,33,34) |
| InChIKey | ACBVNBSWKSWKOK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |