C29H29N5O3S2 — CID 23970118
ethyl 2-[[3,6-diamino-5-cyano-4-(4-ethylphenyl)thieno[2,3-b]pyridine-2-carbonyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 23970118) has the molecular formula C29H29N5O3S2 and a molecular weight of 559.72 g/mol. Its IUPAC name is ethyl 2-[[3,6-diamino-5-cyano-4-(4-ethylphenyl)thieno[2,3-b]pyridine-2-carbonyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3,6-diamino-5-cyano-4-(4-ethylphenyl)thieno[2,3-b]pyridine-2-carbonyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23970118 |
| Molecular Formula | C29H29N5O3S2 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | ethyl 2-[[3,6-diamino-5-cyano-4-(4-ethylphenyl)thieno[2,3-b]pyridine-2-carbonyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2sc3nc(N)c(C#N)c(-c4ccc(CC)cc4)c3c2N)sc2c1CCCCC2 |
| InChI | InChI=1S/C29H29N5O3S2/c1-3-15-10-12-16(13-11-15)20-18(14-30)25(32)33-28-22(20)23(31)24(39-28)26(35)34-27-21(29(36)37-4-2)17-8-6-5-7-9-19(17)38-27/h10-13H,3-9,31H2,1-2H3,(H2,32,33)(H,34,35) |
| InChIKey | MAFLYHGAXXUJDY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |