C29H34INO7S — CID 23834292
(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23834292) has the molecular formula C29H34INO7S and a molecular weight of 667.56 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23834292 |
| Molecular Formula | C29H34INO7S |
| Molecular Weight | 667.56 g/mol |
| Exact Mass | 667.11 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1cc(I)c(O)c(OC)c1)CC[C@@H](O)C1=C(CO)C[C@H]2C(=O)N(Cc3cccs3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C29H34INO7S/c1-3-16(9-17-10-22(30)27(35)24(11-17)38-2)6-7-23(34)25-18(14-32)12-20-26(21(25)15-33)29(37)31(28(20)36)13-19-5-4-8-39-19/h4-5,8-11,20-21,23,26,32-35H,3,6-7,12-15H2,1-2H3/b16-9+/t20-,21+,23-,26-/m1/s1 |
| InChIKey | JBOMLXNZILPKPT-HBGJGSOXSA-N |
| XLogP | 4.10 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|