C32H38INO6 — CID 23890467
(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23890467) has the molecular formula C32H38INO6 and a molecular weight of 659.56 g/mol. Its IUPAC name is (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23890467 |
| Molecular Formula | C32H38INO6 |
| Molecular Weight | 659.56 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC/C(=C\c1cc(I)c(O)c(OC)c1)CC[C@@H](O)C1=C(CC)C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C32H38INO6/c1-4-9-19(14-20-15-25(33)30(37)27(16-20)40-3)12-13-26(36)28-21(5-2)17-23-29(24(28)18-35)32(39)34(31(23)38)22-10-7-6-8-11-22/h6-8,10-11,14-16,23-24,26,29,35-37H,4-5,9,12-13,17-18H2,1-3H3/b19-14+/t23-,24+,26-,29-/m1/s1 |
| InChIKey | HCBYSDMJYHITMX-BFFPHAHESA-N |
| XLogP | 5.85 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|