C30H25N3O4S3 — CID 2383828
methyl 2-[[2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2383828) has the molecular formula C30H25N3O4S3 and a molecular weight of 587.75 g/mol. Its IUPAC name is methyl 2-[[2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2383828 |
| Molecular Formula | C30H25N3O4S3 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | methyl 2-[[2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2nc3scc(-c4ccccc4)c3c(=O)n2-c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C30H25N3O4S3/c1-37-29(36)25-20-14-8-9-15-22(20)40-27(25)31-23(34)17-39-30-32-26-24(21(16-38-26)18-10-4-2-5-11-18)28(35)33(30)19-12-6-3-7-13-19/h2-7,10-13,16H,8-9,14-15,17H2,1H3,(H,31,34) |
| InChIKey | NIKYZQIXNPXCQI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |