C23H18FN3S — CID 2383837
3-[(4-fluorophenyl)methylideneamino]-N-methyl-4-(4-phenylphenyl)-1,3-thiazol-2-imine (PubChem CID 2383837) has the molecular formula C23H18FN3S and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylideneamino]-N-methyl-4-(4-phenylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(4-fluorophenyl)methylideneamino]-N-methyl-4-(4-phenylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2383837 |
| Molecular Formula | C23H18FN3S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-[(4-fluorophenyl)methylideneamino]-N-methyl-4-(4-phenylphenyl)-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(-c3ccccc3)cc2)n1N=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FN3S/c1-25-23-27(26-15-17-7-13-21(24)14-8-17)22(16-28-23)20-11-9-19(10-12-20)18-5-3-2-4-6-18/h2-16H,1H3/b25-23-,26-15? |
| InChIKey | DKVBRPYOCDRYDZ-MERYLAAMSA-N |
| XLogP | 5.44 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|