C28H36N2O5S — CID 23839192
prop-2-enyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23839192) has the molecular formula C28H36N2O5S and a molecular weight of 512.67 g/mol. Its IUPAC name is prop-2-enyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23839192 |
| Molecular Formula | C28H36N2O5S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | prop-2-enyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)c3cc(C)ccc3C)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C28H36N2O5S/c1-7-13-29(20-15-17(3)9-10-18(20)4)25(33)23-28-12-11-27(6,36-28)22(26(34)35-14-8-2)21(28)24(32)30(23)19(5)16-31/h7-10,15,19,21-23,31H,1-2,11-14,16H2,3-6H3/t19-,21+,22-,23?,27+,28?/m1/s1 |
| InChIKey | WBWUSBQPYUKHCE-NBUJHMOOSA-N |
| XLogP | 3.41 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|