C30H40N2O6S — CID 23867435
prop-2-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23867435) has the molecular formula C30H40N2O6S and a molecular weight of 556.73 g/mol. Its IUPAC name is prop-2-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23867435 |
| Molecular Formula | C30H40N2O6S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | prop-2-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C30H40N2O6S/c1-7-16-31(20-10-12-21(37-6)13-11-20)27(35)25-30-15-14-29(5,39-30)24(28(36)38-17-8-2)23(30)26(34)32(25)22(18-33)19(4)9-3/h7-8,10-13,19,22-25,33H,1-2,9,14-18H2,3-6H3/t19-,22-,23-,24+,25?,29-,30?/m0/s1 |
| InChIKey | FOXHNMAHHPCAOG-NCGLXDRBSA-N |
| XLogP | 3.83 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|