C30H40N2O5S — CID 23979383
prop-2-enyl (5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23979383) has the molecular formula C30H40N2O5S and a molecular weight of 540.73 g/mol. Its IUPAC name is prop-2-enyl (5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23979383 |
| Molecular Formula | C30H40N2O5S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | prop-2-enyl (5S,6S,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)Cc3ccccc3)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C30H40N2O5S/c1-6-16-31(18-21-12-10-9-11-13-21)27(35)25-30-15-14-29(5,38-30)24(28(36)37-17-7-2)23(30)26(34)32(25)22(19-33)20(4)8-3/h6-7,9-13,20,22-25,33H,1-2,8,14-19H2,3-5H3/t20-,22-,23-,24-,25?,29+,30?/m0/s1 |
| InChIKey | CMUJYCGQNWNEBV-LCUXXIJGSA-N |
| XLogP | 3.82 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|