C33H46N2O5S — CID 23895354
hex-5-enyl (5S,6R,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23895354) has the molecular formula C33H46N2O5S and a molecular weight of 582.81 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23895354 |
| Molecular Formula | C33H46N2O5S |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | hex-5-enyl (5S,6R,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)Cc3ccccc3)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C33H46N2O5S/c1-6-9-10-14-20-40-31(39)27-26-29(37)35(25(22-36)23(4)8-3)28(33(26)18-17-32(27,5)41-33)30(38)34(19-7-2)21-24-15-12-11-13-16-24/h6-7,11-13,15-16,23,25-28,36H,1-2,8-10,14,17-22H2,3-5H3/t23-,25-,26-,27+,28?,32-,33?/m0/s1 |
| InChIKey | DUTWYSJGOXXQQI-OUUYJOKXSA-N |
| XLogP | 4.99 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|