C32H45N3O4S — CID 23840930
(5S,6R,7S)-2-N-benzyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840930) has the molecular formula C32H45N3O4S and a molecular weight of 567.80 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-benzyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-benzyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840930 |
| Molecular Formula | C32H45N3O4S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | (5S,6R,7S)-2-N-benzyl-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C1N([C@@H](CO)C(C)C)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)CCC)[C@]3(C)CCC12S3 |
| InChI | InChI=1S/C32H45N3O4S/c1-7-17-33(18-8-2)28(37)25-26-29(38)35(24(21-36)22(4)5)27(32(26)16-15-31(25,6)40-32)30(39)34(19-9-3)20-23-13-11-10-12-14-23/h7,9-14,22,24-27,36H,1,3,8,15-21H2,2,4-6H3/t24-,25+,26-,27?,31-,32?/m0/s1 |
| InChIKey | MXQUJUUPQYTDAT-PUAMMZEKSA-N |
| XLogP | 4.12 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|