C35H42ClN3O4S — CID 23897335
(5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897335) has the molecular formula C35H42ClN3O4S and a molecular weight of 636.26 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897335 |
| Molecular Formula | C35H42ClN3O4S |
| Molecular Weight | 636.26 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)C(C)C)C(C(=O)N(CC=C)c3ccc(Cl)cc3)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C35H42ClN3O4S/c1-6-19-37(21-24-11-9-8-10-12-24)31(41)28-29-32(42)39(27(22-40)23(3)4)30(35(29)18-17-34(28,5)44-35)33(43)38(20-7-2)26-15-13-25(36)14-16-26/h6-16,23,27-30,40H,1-2,17-22H2,3-5H3/t27-,28-,29-,30?,34+,35?/m0/s1 |
| InChIKey | PXYJRGPWVOTRQJ-RUTHKKCISA-N |
| XLogP | 5.57 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.26 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|