C38H49N3O4S — CID 23897004
(5S,6R,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897004) has the molecular formula C38H49N3O4S and a molecular weight of 643.89 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897004 |
| Molecular Formula | C38H49N3O4S |
| Molecular Weight | 643.89 g/mol |
| Exact Mass | 643.34 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N(C(CO)CC(C)C)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C38H49N3O4S/c1-8-20-39(23-28-16-11-10-12-17-28)34(43)30-31-35(44)41(29(24-42)22-25(3)4)33(38(31)19-18-37(30,7)46-38)36(45)40(21-9-2)32-26(5)14-13-15-27(32)6/h8-17,25,29-31,33,42H,1-2,18-24H2,3-7H3/t29?,30-,31+,33?,37+,38?/m1/s1 |
| InChIKey | FAZJBCZALUTQAS-BIIPFAGHSA-N |
| XLogP | 5.93 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|