C28H37N3O6 — CID 23840250
(5R,6S,7S)-3-(4-hydroxybutyl)-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840250) has the molecular formula C28H37N3O6 and a molecular weight of 511.62 g/mol. Its IUPAC name is (5R,6S,7S)-3-(4-hydroxybutyl)-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-(4-hydroxybutyl)-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840250 |
| Molecular Formula | C28H37N3O6 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (5R,6S,7S)-3-(4-hydroxybutyl)-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)c2ccc(OC)cc2)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C28H37N3O6/c1-5-15-29(3)25(33)22-21-13-14-28(37-21)23(22)26(34)31(17-7-8-18-32)24(28)27(35)30(16-6-2)19-9-11-20(36-4)12-10-19/h5-6,9-12,21-24,32H,1-2,7-8,13-18H2,3-4H3/t21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | OQOMIKHIEIMNHF-NZJGDCIOSA-N |
| XLogP | 2.01 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|