C34H40ClN3O5 — CID 23896393
(5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23896393) has the molecular formula C34H40ClN3O5 and a molecular weight of 606.16 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23896393 |
| Molecular Formula | C34H40ClN3O5 |
| Molecular Weight | 606.16 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@@H]3CCC12O3)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H40ClN3O5/c1-3-20-36(25-12-8-7-9-13-25)31(40)28-27-18-19-34(43-27)29(28)32(41)38(22-10-5-6-11-23-39)30(34)33(42)37(21-4-2)26-16-14-24(35)15-17-26/h3-4,7-9,12-17,27-30,39H,1-2,5-6,10-11,18-23H2/t27-,28+,29-,30?,34?/m0/s1 |
| InChIKey | AVIWAVOEFBKHIV-JFSIGVLCSA-N |
| XLogP | 5.01 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|