C33H44ClN3O7 — CID 23983509
[(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23983509) has the molecular formula C33H44ClN3O7 and a molecular weight of 630.18 g/mol. Its IUPAC name is [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23983509 |
| Molecular Formula | C33H44ClN3O7 |
| Molecular Weight | 630.18 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)NC[C@H](C)OC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)[C@H](C(=O)N(CC=C)c3ccc(Cl)cc3)[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C33H44ClN3O7/c1-4-6-11-26(39)35-21-22(3)43-32(42)27-25-16-17-33(44-25)28(27)30(40)37(19-9-7-8-10-20-38)29(33)31(41)36(18-5-2)24-14-12-23(34)13-15-24/h4-5,12-15,22,25,27-29,38H,1-2,6-11,16-21H2,3H3,(H,35,39)/t22-,25+,27-,28-,29+,33-/m0/s1 |
| InChIKey | BAJGJRYMZTXMKN-RVRFZCNOSA-N |
| XLogP | 3.80 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|