C28H43N3O7 — CID 25092784
[(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25092784) has the molecular formula C28H43N3O7 and a molecular weight of 533.67 g/mol. Its IUPAC name is [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25092784 |
| Molecular Formula | C28H43N3O7 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | [(2S)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)NC[C@H](C)OC(=O)[C@@H]1[C@H]2C(=O)N(CCCO)[C@H](C(=O)N(CC=C)CCCC)[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C28H43N3O7/c1-5-8-11-21(33)29-18-19(4)37-27(36)22-20-12-13-28(38-20)23(22)25(34)31(16-10-17-32)24(28)26(35)30(14-7-3)15-9-6-2/h5,7,19-20,22-24,32H,1,3,6,8-18H2,2,4H3,(H,29,33)/t19-,20+,22-,23-,24+,28-/m0/s1 |
| InChIKey | BEIIFYJHPYVCPK-VFHANDSQSA-N |
| XLogP | 1.57 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|