C29H45N3O7 — CID 25090299
[(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25090299) has the molecular formula C29H45N3O7 and a molecular weight of 547.69 g/mol. Its IUPAC name is [(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | [(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25090299 |
| Molecular Formula | C29H45N3O7 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | [(2R)-1-(pent-4-enoylamino)propan-2-yl] (1S,2S,5R,6R,7R)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCC(=O)NC[C@@H](C)OC(=O)[C@@H]1[C@H]2C(=O)N([C@H](C)CO)[C@H](C(=O)N(CC=C)CCCCC)[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C29H45N3O7/c1-6-9-11-16-31(15-8-3)27(36)25-29-14-13-21(39-29)23(24(29)26(35)32(25)19(4)18-33)28(37)38-20(5)17-30-22(34)12-10-7-2/h7-8,19-21,23-25,33H,2-3,6,9-18H2,1,4-5H3,(H,30,34)/t19-,20-,21-,23+,24+,25-,29+/m1/s1 |
| InChIKey | YNYIYAXHQAEKHN-OVWWYYMNSA-N |
| XLogP | 1.96 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|