C36H44ClN3O4S — CID 23840977
(5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840977) has the molecular formula C36H44ClN3O4S and a molecular weight of 650.29 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840977 |
| Molecular Formula | C36H44ClN3O4S |
| Molecular Weight | 650.29 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)c2c(C)cccc2Cl)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C36H44ClN3O4S/c1-4-20-38(24-26-15-9-8-10-16-26)33(42)29-28-18-19-36(45-28)30(29)34(43)40(22-11-6-7-12-23-41)32(36)35(44)39(21-5-2)31-25(3)14-13-17-27(31)37/h4-5,8-10,13-17,28-30,32,41H,1-2,6-7,11-12,18-24H2,3H3/t28-,29+,30-,32?,36?/m0/s1 |
| InChIKey | JIGACNIHHRNRBZ-OVALLKKPSA-N |
| XLogP | 6.03 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|