C38H40ClN3O4S — CID 25083451
(5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25083451) has the molecular formula C38H40ClN3O4S and a molecular weight of 670.28 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25083451 |
| Molecular Formula | C38H40ClN3O4S |
| Molecular Weight | 670.28 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-(2-chloro-6-methylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)c2c(C)cccc2Cl)N([C@H](CO)c2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C38H40ClN3O4S/c1-4-21-40(23-26-14-8-6-9-15-26)35(44)31-30-19-20-38(47-30)32(31)36(45)42(29(24-43)27-16-10-7-11-17-27)34(38)37(46)41(22-5-2)33-25(3)13-12-18-28(33)39/h4-18,29-32,34,43H,1-2,19-24H2,3H3/t29-,30+,31-,32+,34?,38?/m1/s1 |
| InChIKey | DUQZZBLVNXXFOL-PAJMBFQYSA-N |
| XLogP | 6.21 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.28 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|