C15H11N2O2S2- — CID 2384231
2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoate (PubChem CID 2384231) has the molecular formula C15H11N2O2S2- and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoate.
| Compound Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoate |
|---|---|
| PubChem CID | 2384231 |
| Molecular Formula | C15H11N2O2S2- |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoate |
| SMILES | Cc1sc2ncnc(Sc3ccccc3C(=O)[O-])c2c1C |
| InChI | InChI=1S/C15H12N2O2S2/c1-8-9(2)20-13-12(8)14(17-7-16-13)21-11-6-4-3-5-10(11)15(18)19/h3-7H,1-2H3,(H,18,19)/p-1 |
| InChIKey | TZPXEPYUAQIFRO-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |