C26H27IN4O3 — CID 23846617
(3R,3'S,5'S)-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23846617) has the molecular formula C26H27IN4O3 and a molecular weight of 570.43 g/mol. Its IUPAC name is (3R,3'S,5'S)-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'S,5'S)-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23846617 |
| Molecular Formula | C26H27IN4O3 |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | (3R,3'S,5'S)-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C=CCN1C(=O)[C@]2(O[C@H](CCn3cc([C@H](O)c4ccccc4)nn3)C[C@@H]2C)c2cc(I)ccc21 |
| InChI | InChI=1S/C26H27IN4O3/c1-3-12-31-23-10-9-19(27)15-21(23)26(25(31)33)17(2)14-20(34-26)11-13-30-16-22(28-29-30)24(32)18-7-5-4-6-8-18/h3-10,15-17,20,24,32H,1,11-14H2,2H3/t17-,20+,24+,26+/m0/s1 |
| InChIKey | PLWJKVCYPZKHMU-RMXZTVFFSA-N |
| XLogP | 4.21 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|