C18H13ClNO5- — CID 2384695
4-[(Z)-1-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxoprop-1-enyl]benzoate (PubChem CID 2384695) has the molecular formula C18H13ClNO5- and a molecular weight of 358.76 g/mol. Its IUPAC name is 4-[(Z)-1-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxoprop-1-enyl]benzoate.
| Compound Name | 4-[(Z)-1-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 2384695 |
| Molecular Formula | C18H13ClNO5- |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 4-[(Z)-1-[(4-chlorobenzoyl)amino]-3-methoxy-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)/C=C(\NC(=O)c1ccc(Cl)cc1)c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H14ClNO5/c1-25-16(21)10-15(11-2-4-13(5-3-11)18(23)24)20-17(22)12-6-8-14(19)9-7-12/h2-10H,1H3,(H,20,22)(H,23,24)/p-1/b15-10- |
| InChIKey | QHGVJAGGXKRYBW-GDNBJRDFSA-M |
| XLogP | 1.65 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|