C20H18N4OS2 — CID 23853044
7-phenyl-5-prop-2-enylsulfanyl-16-thia-3,4,6,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15)-tetraen-8-one (PubChem CID 23853044) has the molecular formula C20H18N4OS2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 7-phenyl-5-prop-2-enylsulfanyl-16-thia-3,4,6,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15)-tetraen-8-one.
| Compound Name | 7-phenyl-5-prop-2-enylsulfanyl-16-thia-3,4,6,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 23853044 |
| Molecular Formula | C20H18N4OS2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 7-phenyl-5-prop-2-enylsulfanyl-16-thia-3,4,6,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15)-tetraen-8-one |
| SMILES | C=CCSc1nnc2c3sc4c(c3c(=O)n(-c3ccccc3)n12)CCCC4 |
| InChI | InChI=1S/C20H18N4OS2/c1-2-12-26-20-22-21-18-17-16(14-10-6-7-11-15(14)27-17)19(25)23(24(18)20)13-8-4-3-5-9-13/h2-5,8-9H,1,6-7,10-12H2 |
| InChIKey | DQDWBYDPJXDUPU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|