C19H16N4OS2 — CID 171987335
7-phenyl-5-prop-2-enylsulfanyl-10-thia-3,4,6,7-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,11(15)-tetraen-8-one (PubChem CID 171987335) has the molecular formula C19H16N4OS2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 7-phenyl-5-prop-2-enylsulfanyl-10-thia-3,4,6,7-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,11(15)-tetraen-8-one.
| Compound Name | 7-phenyl-5-prop-2-enylsulfanyl-10-thia-3,4,6,7-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,11(15)-tetraen-8-one |
|---|---|
| PubChem CID | 171987335 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 7-phenyl-5-prop-2-enylsulfanyl-10-thia-3,4,6,7-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,11(15)-tetraen-8-one |
| SMILES | C=CCSc1nnc2c3c4c(sc3c(=O)n(-c3ccccc3)n12)CCC4 |
| InChI | InChI=1S/C19H16N4OS2/c1-2-11-25-19-21-20-17-15-13-9-6-10-14(13)26-16(15)18(24)22(23(17)19)12-7-4-3-5-8-12/h2-5,7-8H,1,6,9-11H2 |
| InChIKey | OWPLOPIWRZXYSY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|