C25H24FN7O3S — CID 23853561
N-(2,5-dimethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide (PubChem CID 23853561) has the molecular formula C25H24FN7O3S and a molecular weight of 521.58 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 23853561 |
| Molecular Formula | C25H24FN7O3S |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CSc2nnc3n(Cc4ccc(F)cc4)c4c(=O)n(C)c(=O)n(C)c4n23)c1 |
| InChI | InChI=1S/C25H24FN7O3S/c1-14-5-6-15(2)18(11-14)27-19(34)13-37-24-29-28-23-32(12-16-7-9-17(26)10-8-16)20-21(33(23)24)30(3)25(36)31(4)22(20)35/h5-11H,12-13H2,1-4H3,(H,27,34) |
| InChIKey | HFLWKYCRMTXOCR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |