C27H28FN7O3S — CID 23738389
N-(2,6-diethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide (PubChem CID 23738389) has the molecular formula C27H28FN7O3S and a molecular weight of 549.63 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 23738389 |
| Molecular Formula | C27H28FN7O3S |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[5-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanylacetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CSc1nnc2n(Cc3ccc(F)cc3)c3c(=O)n(C)c(=O)n(C)c3n12 |
| InChI | InChI=1S/C27H28FN7O3S/c1-5-17-8-7-9-18(6-2)21(17)29-20(36)15-39-26-31-30-25-34(14-16-10-12-19(28)13-11-16)22-23(35(25)26)32(3)27(38)33(4)24(22)37/h7-13H,5-6,14-15H2,1-4H3,(H,29,36) |
| InChIKey | CEKQWWZVOHPQJJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |