C25H24ClN7O5S — CID 23884188
2-[5-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanyl-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 23884188) has the molecular formula C25H24ClN7O5S and a molecular weight of 570.03 g/mol. Its IUPAC name is 2-[5-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanyl-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[5-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanyl-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23884188 |
| Molecular Formula | C25H24ClN7O5S |
| Molecular Weight | 570.03 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 2-[5-[(4-chlorophenyl)methyl]-1,3-dimethyl-2,4-dioxopurino[8,9-c][1,2,4]triazol-8-yl]sulfanyl-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc3n(Cc4ccc(Cl)cc4)c4c(=O)n(C)c(=O)n(C)c4n23)c(OC)c1 |
| InChI | InChI=1S/C25H24ClN7O5S/c1-30-21-20(22(35)31(2)25(30)36)32(12-14-5-7-15(26)8-6-14)23-28-29-24(33(21)23)39-13-19(34)27-17-10-9-16(37-3)11-18(17)38-4/h5-11H,12-13H2,1-4H3,(H,27,34) |
| InChIKey | YXHDAQXKQPTPAJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.03 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |