C19H17BrN2O4 — CID 23854004
3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 23854004) has the molecular formula C19H17BrN2O4 and a molecular weight of 417.26 g/mol. Its IUPAC name is 3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 23854004 |
| Molecular Formula | C19H17BrN2O4 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCN1C(=O)C2ON(c3ccccc3)C(c3cc(Br)ccc3O)C2C1=O |
| InChI | InChI=1S/C19H17BrN2O4/c1-2-21-18(24)15-16(13-10-11(20)8-9-14(13)23)22(26-17(15)19(21)25)12-6-4-3-5-7-12/h3-10,15-17,23H,2H2,1H3 |
| InChIKey | SSYZHPKOYJCQKE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|