C20H19BrN2O4 — CID 23967456
3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-(2-methylphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 23967456) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is 3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-(2-methylphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-(2-methylphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 23967456 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3-(5-bromo-2-hydroxyphenyl)-5-ethyl-2-(2-methylphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCN1C(=O)C2ON(c3ccccc3C)C(c3cc(Br)ccc3O)C2C1=O |
| InChI | InChI=1S/C20H19BrN2O4/c1-3-22-19(25)16-17(13-10-12(21)8-9-15(13)24)23(27-18(16)20(22)26)14-7-5-4-6-11(14)2/h4-10,16-18,24H,3H2,1-2H3 |
| InChIKey | FVAQKXFNIYPFSH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|