C32H28ClN3O3S — CID 23854921
3-(4-chlorophenyl)-1-N,5-diphenyl-2-N-prop-2-enyl-4-(thiophene-2-carbonyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 23854921) has the molecular formula C32H28ClN3O3S and a molecular weight of 570.11 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-N,5-diphenyl-2-N-prop-2-enyl-4-(thiophene-2-carbonyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 3-(4-chlorophenyl)-1-N,5-diphenyl-2-N-prop-2-enyl-4-(thiophene-2-carbonyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 23854921 |
| Molecular Formula | C32H28ClN3O3S |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-N,5-diphenyl-2-N-prop-2-enyl-4-(thiophene-2-carbonyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)C1C(c2ccc(Cl)cc2)C(C(=O)c2cccs2)C(c2ccccc2)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H28ClN3O3S/c1-2-19-34-31(38)29-26(21-15-17-23(33)18-16-21)27(30(37)25-14-9-20-40-25)28(22-10-5-3-6-11-22)36(29)32(39)35-24-12-7-4-8-13-24/h2-18,20,26-29H,1,19H2,(H,34,38)(H,35,39) |
| InChIKey | QQSHCWXLTKBYTJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|