C13H13Br2NO3S2 — CID 23855426
N-benzyl-4,5-dibromo-N-(2-hydroxyethyl)thiophene-2-sulfonamide (PubChem CID 23855426) has the molecular formula C13H13Br2NO3S2 and a molecular weight of 455.19 g/mol. Its IUPAC name is N-benzyl-4,5-dibromo-N-(2-hydroxyethyl)thiophene-2-sulfonamide.
| Compound Name | N-benzyl-4,5-dibromo-N-(2-hydroxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23855426 |
| Molecular Formula | C13H13Br2NO3S2 |
| Molecular Weight | 455.19 g/mol |
| Exact Mass | 452.87 |
| IUPAC Name | N-benzyl-4,5-dibromo-N-(2-hydroxyethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1cc(Br)c(Br)s1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C13H13Br2NO3S2/c14-11-8-12(20-13(11)15)21(18,19)16(6-7-17)9-10-4-2-1-3-5-10/h1-5,8,17H,6-7,9H2 |
| InChIKey | QNHPQLOUYUOKSF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |