C9H12ClN3O3S — CID 2386052
4-chloro-N-(2-hydrazinyl-2-oxoethyl)-N-methylbenzenesulfonamide (PubChem CID 2386052) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is 4-chloro-N-(2-hydrazinyl-2-oxoethyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-hydrazinyl-2-oxoethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2386052 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 4-chloro-N-(2-hydrazinyl-2-oxoethyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CC(=O)NN)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H12ClN3O3S/c1-13(6-9(14)12-11)17(15,16)8-4-2-7(10)3-5-8/h2-5H,6,11H2,1H3,(H,12,14) |
| InChIKey | ZNEMQMKLKHLXMX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|