C8H8ClN3O5S — CID 3047115
2-[2-(4-chlorophenyl)sulfonylhydrazinyl]-N-hydroxy-2-oxoacetamide (PubChem CID 3047115) has the molecular formula C8H8ClN3O5S and a molecular weight of 293.69 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylhydrazinyl]-N-hydroxy-2-oxoacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylhydrazinyl]-N-hydroxy-2-oxoacetamide |
|---|---|
| PubChem CID | 3047115 |
| Molecular Formula | C8H8ClN3O5S |
| Molecular Weight | 293.69 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylhydrazinyl]-N-hydroxy-2-oxoacetamide |
| SMILES | O=C(NO)C(=O)NNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8ClN3O5S/c9-5-1-3-6(4-2-5)18(16,17)12-10-7(13)8(14)11-15/h1-4,12,15H,(H,10,13)(H,11,14) |
| InChIKey | IANDQIKRQCKYSB-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.69 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|