C26H23N5O3S — CID 2386507
N-[3-[1-[[2-benzylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]amino]ethenyl]phenyl]acetamide (PubChem CID 2386507) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[3-[1-[[2-benzylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]amino]ethenyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[[2-benzylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]amino]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2386507 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | N-[3-[1-[[2-benzylimino-4-(4-nitrophenyl)-1,3-thiazol-3-yl]amino]ethenyl]phenyl]acetamide |
| SMILES | C=C(Nn1c(-c2ccc([N+](=O)[O-])cc2)cs/c1=N\Cc1ccccc1)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C26H23N5O3S/c1-18(22-9-6-10-23(15-22)28-19(2)32)29-30-25(21-11-13-24(14-12-21)31(33)34)17-35-26(30)27-16-20-7-4-3-5-8-20/h3-15,17,29H,1,16H2,2H3,(H,28,32)/b27-26- |
| InChIKey | FZSDHGLODCAMKZ-RQZHXJHFSA-N |
| XLogP | 5.40 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|