C30H48N2O6 — CID 23867400
prop-2-enyl (5R,6S,7S)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23867400) has the molecular formula C30H48N2O6 and a molecular weight of 532.72 g/mol. Its IUPAC name is prop-2-enyl (5R,6S,7S)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5R,6S,7S)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23867400 |
| Molecular Formula | C30H48N2O6 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | prop-2-enyl (5R,6S,7S)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C30H48N2O6/c1-10-16-31(28(8,9)19-27(5,6)7)25(35)23-30-15-14-29(13-4,38-30)22(26(36)37-17-11-2)21(30)24(34)32(23)20(12-3)18-33/h10-11,20-23,33H,1-2,12-19H2,3-9H3/t20?,21-,22+,23?,29-,30?/m0/s1 |
| InChIKey | KZISBGWYDAJCAJ-QJEWWQLASA-N |
| XLogP | 3.87 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|