C27H43N3O5 — CID 23868649
(5R,6S,7S)-2-N-tert-butyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868649) has the molecular formula C27H43N3O5 and a molecular weight of 489.66 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-tert-butyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-tert-butyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868649 |
| Molecular Formula | C27H43N3O5 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (5R,6S,7S)-2-N-tert-butyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CC)CO)C(C(=O)N(CC=C)C(C)(C)C)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C27H43N3O5/c1-9-15-28(8)22(32)19-20-23(33)30(18(11-3)17-31)21(24(34)29(16-10-2)25(5,6)7)27(20)14-13-26(19,12-4)35-27/h9-10,18-21,31H,1-2,11-17H2,3-8H3/t18-,19+,20-,21?,26-,27?/m0/s1 |
| InChIKey | NPOOWRRCMLOXIT-UYYQUSARSA-N |
| XLogP | 2.37 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|