C34H37N3O5 — CID 23868423
(5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868423) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868423 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2N([C@@H](CO)Cc3ccccc3)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@@H]4CCC23O4)c1 |
| InChI | InChI=1S/C34H37N3O5/c1-21-13-14-22(2)26(17-21)36-32(40)30-34-16-15-27(42-34)28(31(39)35-19-24-11-7-4-8-12-24)29(34)33(41)37(30)25(20-38)18-23-9-5-3-6-10-23/h3-14,17,25,27-30,38H,15-16,18-20H2,1-2H3,(H,35,39)(H,36,40)/t25-,27+,28-,29+,30?,34?/m1/s1 |
| InChIKey | MUHCDIFKKFTSAA-AVDJCTIBSA-N |
| XLogP | 3.54 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |