C32H44N6O5 — CID 23868958
(5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868958) has the molecular formula C32H44N6O5 and a molecular weight of 592.74 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868958 |
| Molecular Formula | C32H44N6O5 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | (5R,6R,7R)-2-N-(benzotriazol-1-ylmethyl)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)CCC)[C@@]3(CC)CCC12O3 |
| InChI | InChI=1S/C32H44N6O5/c1-5-17-35(18-6-2)28(40)25-26-29(41)37(20-11-12-21-39)27(32(26)16-15-31(25,8-4)43-32)30(42)36(19-7-3)22-38-24-14-10-9-13-23(24)33-34-38/h5,7,9-10,13-14,25-27,39H,1,3,6,8,11-12,15-22H2,2,4H3/t25-,26-,27?,31+,32?/m0/s1 |
| InChIKey | IVUNNZDNWZGNRQ-OFFCGTLFSA-N |
| XLogP | 2.76 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|