C28H37NO4S — CID 23872016
2-[(3R,4aR,6aR,7S,8R,10bR)-3-benzyl-8-hydroxy-6a,10b-dimethyl-4a,5,6,7,8,9,10,10a-octahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 23872016) has the molecular formula C28H37NO4S and a molecular weight of 483.67 g/mol. Its IUPAC name is 2-[(3R,4aR,6aR,7S,8R,10bR)-3-benzyl-8-hydroxy-6a,10b-dimethyl-4a,5,6,7,8,9,10,10a-octahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(3R,4aR,6aR,7S,8R,10bR)-3-benzyl-8-hydroxy-6a,10b-dimethyl-4a,5,6,7,8,9,10,10a-octahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 23872016 |
| Molecular Formula | C28H37NO4S |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[(3R,4aR,6aR,7S,8R,10bR)-3-benzyl-8-hydroxy-6a,10b-dimethyl-4a,5,6,7,8,9,10,10a-octahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C[C@@]12CO[C@@H](Cc3ccccc3)O[C@@H]1CC[C@]1(C)C2CC[C@@H](O)[C@H]1CC(=O)NCc1cccs1 |
| InChI | InChI=1S/C28H37NO4S/c1-27-13-12-24-28(2,18-32-26(33-24)15-19-7-4-3-5-8-19)23(27)11-10-22(30)21(27)16-25(31)29-17-20-9-6-14-34-20/h3-9,14,21-24,26,30H,10-13,15-18H2,1-2H3,(H,29,31)/t21-,22-,23?,24-,26-,27+,28+/m1/s1 |
| InChIKey | KDYJWWBRZFDDML-NZSGXIPLSA-N |
| XLogP | 4.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |