C22H32FNO4 — CID 44716974
2-[(1S,2R,5R,6R,8aR)-2,6-dihydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 44716974) has the molecular formula C22H32FNO4 and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-[(1S,2R,5R,6R,8aR)-2,6-dihydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(1S,2R,5R,6R,8aR)-2,6-dihydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 44716974 |
| Molecular Formula | C22H32FNO4 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-[(1S,2R,5R,6R,8aR)-2,6-dihydroxy-5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | C[C@]1(CO)C2CC[C@@H](O)[C@@H](CC(=O)NCc3ccc(F)cc3)[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C22H32FNO4/c1-21-10-9-19(27)22(2,13-25)18(21)8-7-17(26)16(21)11-20(28)24-12-14-3-5-15(23)6-4-14/h3-6,16-19,25-27H,7-13H2,1-2H3,(H,24,28)/t16-,17-,18?,19-,21+,22+/m1/s1 |
| InChIKey | USQJMVUJYMEINF-KZJXIDHRSA-N |
| XLogP | 2.38 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |