C25H38N2O5 — CID 162803266
[(1R,2S,4aS,5S,6R,8aS)-5-[2-(benzylamino)-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-ethylcarbamate (PubChem CID 162803266) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is [(1R,2S,4aS,5S,6R,8aS)-5-[2-(benzylamino)-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-ethylcarbamate.
| Compound Name | [(1R,2S,4aS,5S,6R,8aS)-5-[2-(benzylamino)-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 162803266 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | [(1R,2S,4aS,5S,6R,8aS)-5-[2-(benzylamino)-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H](O)[C@H]2CC(=O)NCc2ccccc2)[C@]1(C)CO |
| InChI | InChI=1S/C25H38N2O5/c1-4-26-23(31)32-21-12-13-24(2)18(19(29)10-11-20(24)25(21,3)16-28)14-22(30)27-15-17-8-6-5-7-9-17/h5-9,18-21,28-29H,4,10-16H2,1-3H3,(H,26,31)(H,27,30)/t18-,19-,20+,21+,24-,25+/m1/s1 |
| InChIKey | GRNHXBHXQBSANN-AEQMUBOASA-N |
| XLogP | 2.99 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |