C26H36F2N2O5 — CID 44716877
[(1R,2R,4aR,5S,6R)-5-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate (PubChem CID 44716877) has the molecular formula C26H36F2N2O5 and a molecular weight of 494.58 g/mol. Its IUPAC name is [(1R,2R,4aR,5S,6R)-5-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate.
| Compound Name | [(1R,2R,4aR,5S,6R)-5-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 44716877 |
| Molecular Formula | C26H36F2N2O5 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | [(1R,2R,4aR,5S,6R)-5-[2-[(3,5-difluorophenyl)methylamino]-2-oxoethyl]-6-hydroxy-1-(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)O[C@@H]1CC[C@]2(C)C(CC[C@@H](O)[C@H]2CC(=O)NCc2cc(F)cc(F)c2)[C@]1(C)CO |
| InChI | InChI=1S/C26H36F2N2O5/c1-4-9-29-24(34)35-22-7-8-25(2)19(20(32)5-6-21(25)26(22,3)15-31)13-23(33)30-14-16-10-17(27)12-18(28)11-16/h4,10-12,19-22,31-32H,1,5-9,13-15H2,2-3H3,(H,29,34)(H,30,33)/t19-,20-,21?,22-,25+,26+/m1/s1 |
| InChIKey | SYGRVAJRQKKPJC-RDRNDQBRSA-N |
| XLogP | 3.44 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|