C21H26N4O3 — CID 23874086
(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-prop-2-enylindol-2-one (PubChem CID 23874086) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-prop-2-enylindol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 23874086 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@@](O)([C@@H](C)/C=C/CCn2cc(CCO)nn2)c2ccccc21 |
| InChI | InChI=1S/C21H26N4O3/c1-3-12-25-19-10-5-4-9-18(19)21(28,20(25)27)16(2)8-6-7-13-24-15-17(11-14-26)22-23-24/h3-6,8-10,15-16,26,28H,1,7,11-14H2,2H3/b8-6+/t16-,21+/m0/s1 |
| InChIKey | GXQATUHWFCNBQU-ZITAYMCYSA-N |
| XLogP | 1.82 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|