C22H28N4O4 — CID 23817597
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-1-prop-2-enylindol-2-one (PubChem CID 23817597) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-1-prop-2-enylindol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 23817597 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@](O)([C@H](C)/C=C/CCn2cc(CCO)nn2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C22H28N4O4/c1-4-11-26-20-9-8-18(30-3)14-19(20)22(29,21(26)28)16(2)7-5-6-12-25-15-17(10-13-27)23-24-25/h4-5,7-9,14-16,27,29H,1,6,10-13H2,2-3H3/b7-5+/t16-,22+/m1/s1 |
| InChIKey | APZJVEAXGPLWJC-QYUAPJNHSA-N |
| XLogP | 1.82 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|