C27H35N5O7 — CID 23759692
methyl 5-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxo-1,3-oxazolidin-3-yl)indol-1-yl]pentanoate (PubChem CID 23759692) has the molecular formula C27H35N5O7 and a molecular weight of 541.61 g/mol. Its IUPAC name is methyl 5-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxo-1,3-oxazolidin-3-yl)indol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxo-1,3-oxazolidin-3-yl)indol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23759692 |
| Molecular Formula | C27H35N5O7 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | methyl 5-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxo-1,3-oxazolidin-3-yl)indol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@](O)([C@@H](C)/C=C/CCn2cc(CCO)nn2)c2cc(N3CCOC3=O)ccc21 |
| InChI | InChI=1S/C27H35N5O7/c1-19(7-3-5-12-30-18-20(11-15-33)28-29-30)27(37)22-17-21(31-14-16-39-26(31)36)9-10-23(22)32(25(27)35)13-6-4-8-24(34)38-2/h3,7,9-10,17-19,33,37H,4-6,8,11-16H2,1-2H3/b7-3+/t19-,27+/m0/s1 |
| InChIKey | GONVMBMAVGTNBX-JBDMVKEXSA-N |
| XLogP | 1.93 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|